C15H10ClF3N2O — CID 145013764
7-chloro-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine (PubChem CID 145013764) has the molecular formula C15H10ClF3N2O and a molecular weight of 326.71 g/mol. Its IUPAC name is 7-chloro-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine.
| Compound Name | 7-chloro-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 145013764 |
| Molecular Formula | C15H10ClF3N2O |
| Molecular Weight | 326.71 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 7-chloro-5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine |
| SMILES | Cc1cc(Cl)c2oc(-c3ccc(C(F)(F)F)cc3)nc2c1N |
| InChI | InChI=1S/C15H10ClF3N2O/c1-7-6-10(16)13-12(11(7)20)21-14(22-13)8-2-4-9(5-3-8)15(17,18)19/h2-6H,20H2,1H3 |
| InChIKey | RFWRNRPLKZEDBZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|