C19H13F6NS — CID 134841274
4-methyl-2,5-bis[4-(trifluoromethyl)phenyl]thiophen-3-amine (PubChem CID 134841274) has the molecular formula C19H13F6NS and a molecular weight of 401.38 g/mol. Its IUPAC name is 4-methyl-2,5-bis[4-(trifluoromethyl)phenyl]thiophen-3-amine.
| Compound Name | 4-methyl-2,5-bis[4-(trifluoromethyl)phenyl]thiophen-3-amine |
|---|---|
| PubChem CID | 134841274 |
| Molecular Formula | C19H13F6NS |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 4-methyl-2,5-bis[4-(trifluoromethyl)phenyl]thiophen-3-amine |
| SMILES | Cc1c(-c2ccc(C(F)(F)F)cc2)sc(-c2ccc(C(F)(F)F)cc2)c1N |
| InChI | InChI=1S/C19H13F6NS/c1-10-15(26)17(12-4-8-14(9-5-12)19(23,24)25)27-16(10)11-2-6-13(7-3-11)18(20,21)22/h2-9H,26H2,1H3 |
| InChIKey | LWARPRFPDMLMGQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |