C13H11F3S — CID 141064472
3,5-dimethyl-2-[4-(trifluoromethyl)phenyl]thiophene (PubChem CID 141064472) has the molecular formula C13H11F3S and a molecular weight of 256.29 g/mol. Its IUPAC name is 3,5-dimethyl-2-[4-(trifluoromethyl)phenyl]thiophene.
| Compound Name | 3,5-dimethyl-2-[4-(trifluoromethyl)phenyl]thiophene |
|---|---|
| PubChem CID | 141064472 |
| Molecular Formula | C13H11F3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3,5-dimethyl-2-[4-(trifluoromethyl)phenyl]thiophene |
| SMILES | Cc1cc(C)c(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C13H11F3S/c1-8-7-9(2)17-12(8)10-3-5-11(6-4-10)13(14,15)16/h3-7H,1-2H3 |
| InChIKey | KZBFKCBQHWPANZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |