C17H14Cl2F3N3O2 — CID 158413149
5,7-dichloro-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine;N,N-dimethylformamide (PubChem CID 158413149) has the molecular formula C17H14Cl2F3N3O2 and a molecular weight of 420.22 g/mol. Its IUPAC name is 5,7-dichloro-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine;N,N-dimethylformamide.
| Compound Name | 5,7-dichloro-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine;N,N-dimethylformamide |
|---|---|
| PubChem CID | 158413149 |
| Molecular Formula | C17H14Cl2F3N3O2 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 5,7-dichloro-2-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-4-amine;N,N-dimethylformamide |
| SMILES | CN(C)C=O.Nc1c(Cl)cc(Cl)c2oc(-c3ccc(C(F)(F)F)cc3)nc12 |
| InChI | InChI=1S/C14H7Cl2F3N2O.C3H7NO/c15-8-5-9(16)12-11(10(8)20)21-13(22-12)6-1-3-7(4-2-6)14(17,18)19;1-4(2)3-5/h1-5H,20H2;3H,1-2H3 |
| InChIKey | GZODPKWKJNOCCT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|