About 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one
5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one (PubChem CID 14501445) has the molecular formula C14H16ClNO2
and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one.
Molecular Properties
| Compound Name | 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one |
| PubChem CID | 14501445 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one |
| SMILES | CC(C)(C)C(=O)N1CCC(=O)c2c(Cl)cccc21 |
| InChI | InChI=1S/C14H16ClNO2/c1-14(2,3)13(18)16-8-7-11(17)12-9(15)5-4-6-10(12)16/h4-6H,7-8H2,1-3H3 |
| InChIKey | SAJRJFHFOUOQNN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one?
The IUPAC name of 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one (CID 14501445) is 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one.
What is the SMILES notation for 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one?
The canonical SMILES for 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one is CC(C)(C)C(=O)N1CCC(=O)c2c(Cl)cccc21.
What is the InChIKey of 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one?
The InChIKey is SAJRJFHFOUOQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNO2/c1-14(2,3)13(18)16-8-7-11(17)12-9(15)5-4-6-10(12)16/h4-6H,7-8H2,1-3H3.
What are the key properties of 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one?
5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one has a molecular weight of 265.74 g/mol, XLogP of 3.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-one is sourced from PubChem (CID 14501445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).