About 4-ethylaniline;2-hydroxy-2-phenylacetamide
4-ethylaniline;2-hydroxy-2-phenylacetamide (PubChem CID 145017950) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-ethylaniline;2-hydroxy-2-phenylacetamide.
Molecular Properties
| Compound Name | 4-ethylaniline;2-hydroxy-2-phenylacetamide |
| PubChem CID | 145017950 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-ethylaniline;2-hydroxy-2-phenylacetamide |
| SMILES | CCc1ccc(N)cc1.NC(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C8H11N/c9-8(11)7(10)6-4-2-1-3-5-6;1-2-7-3-5-8(9)6-4-7/h1-5,7,10H,(H2,9,11);3-6H,2,9H2,1H3 |
| InChIKey | RNFGUARRHGTTCZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylaniline;2-hydroxy-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylaniline;2-hydroxy-2-phenylacetamide?
The IUPAC name of 4-ethylaniline;2-hydroxy-2-phenylacetamide (CID 145017950) is 4-ethylaniline;2-hydroxy-2-phenylacetamide.
What is the SMILES notation for 4-ethylaniline;2-hydroxy-2-phenylacetamide?
The canonical SMILES for 4-ethylaniline;2-hydroxy-2-phenylacetamide is CCc1ccc(N)cc1.NC(=O)C(O)c1ccccc1.
What is the InChIKey of 4-ethylaniline;2-hydroxy-2-phenylacetamide?
The InChIKey is RNFGUARRHGTTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C8H11N/c9-8(11)7(10)6-4-2-1-3-5-6;1-2-7-3-5-8(9)6-4-7/h1-5,7,10H,(H2,9,11);3-6H,2,9H2,1H3.
What are the key properties of 4-ethylaniline;2-hydroxy-2-phenylacetamide?
4-ethylaniline;2-hydroxy-2-phenylacetamide has a molecular weight of 272.35 g/mol, XLogP of 2.04, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylaniline;2-hydroxy-2-phenylacetamide is sourced from PubChem (CID 145017950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).