C18H21NO2 — CID 89454615
2-hydroxy-2-[3-(4-phenylbutyl)phenyl]acetamide (PubChem CID 89454615) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(4-phenylbutyl)phenyl]acetamide.
| Compound Name | 2-hydroxy-2-[3-(4-phenylbutyl)phenyl]acetamide |
|---|---|
| PubChem CID | 89454615 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-hydroxy-2-[3-(4-phenylbutyl)phenyl]acetamide |
| SMILES | NC(=O)C(O)c1cccc(CCCCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21NO2/c19-18(21)17(20)16-12-6-11-15(13-16)10-5-4-9-14-7-2-1-3-8-14/h1-3,6-8,11-13,17,20H,4-5,9-10H2,(H2,19,21) |
| InChIKey | AKZJXVMRXHDIRV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|