C18H22N4O5S — CID 145018130
tert-butyl 3-[(3E)-2-nitrohexa-1,3,5-trien-3-yl]-4-oxo-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate (PubChem CID 145018130) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is tert-butyl 3-[(3E)-2-nitrohexa-1,3,5-trien-3-yl]-4-oxo-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 3-[(3E)-2-nitrohexa-1,3,5-trien-3-yl]-4-oxo-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 145018130 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | tert-butyl 3-[(3E)-2-nitrohexa-1,3,5-trien-3-yl]-4-oxo-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-6-carboxylate |
| SMILES | C=C/C=C(\C(=C)[N+](=O)[O-])n1c(=S)[nH]c2c(c1=O)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H22N4O5S/c1-6-7-14(11(2)22(25)26)21-15(23)12-10-20(17(24)27-18(3,4)5)9-8-13(12)19-16(21)28/h6-7H,1-2,8-10H2,3-5H3,(H,19,28)/b14-7+ |
| InChIKey | CECVTTWFWAWNDP-VGOFMYFVSA-N |
| XLogP | 3.02 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|