C18H25N3O4S — CID 91034432
tert-butyl 3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]piperidine-1-carboxylate (PubChem CID 91034432) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is tert-butyl 3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91034432 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl 3-[(6-hydroxy-4-oxo-1-prop-2-enyl-2-sulfanylidenepyrimidin-5-yl)methylidene]piperidine-1-carboxylate |
| SMILES | C=CCn1c(O)c(C=C2CCCN(C(=O)OC(C)(C)C)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C18H25N3O4S/c1-5-8-21-15(23)13(14(22)19-16(21)26)10-12-7-6-9-20(11-12)17(24)25-18(2,3)4/h5,10,23H,1,6-9,11H2,2-4H3,(H,19,22,26) |
| InChIKey | VLTSXOOHDBNBRV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|