C24H28N2O — CID 145019857
4-[(1S)-2-[3-(C,N-dimethylcarbonimidoyl)-4-methylbenzoyl]cyclohexyl]benzonitrile;molecular hydrogen (PubChem CID 145019857) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[(1S)-2-[3-(C,N-dimethylcarbonimidoyl)-4-methylbenzoyl]cyclohexyl]benzonitrile;molecular hydrogen.
| Compound Name | 4-[(1S)-2-[3-(C,N-dimethylcarbonimidoyl)-4-methylbenzoyl]cyclohexyl]benzonitrile;molecular hydrogen |
|---|---|
| PubChem CID | 145019857 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 4-[(1S)-2-[3-(C,N-dimethylcarbonimidoyl)-4-methylbenzoyl]cyclohexyl]benzonitrile;molecular hydrogen |
| SMILES | C/N=C(\C)c1cc(C(=O)C2CCCC[C@@H]2c2ccc(C#N)cc2)ccc1C.[H][H] |
| InChI | InChI=1S/C24H26N2O.H2/c1-16-8-11-20(14-23(16)17(2)26-3)24(27)22-7-5-4-6-21(22)19-12-9-18(15-25)10-13-19;/h8-14,21-22H,4-7H2,1-3H3;1H/b26-17+;/t21-,22?;/m1./s1 |
| InChIKey | GEOMVJLKFXWGCR-JFQVCZJRSA-N |
| XLogP | 5.71 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|