C23H33NO3 — CID 145021507
[(1S)-3-[(6S)-6-[(E)-hex-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl carbamate (PubChem CID 145021507) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is [(1S)-3-[(6S)-6-[(E)-hex-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl carbamate.
| Compound Name | [(1S)-3-[(6S)-6-[(E)-hex-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl carbamate |
|---|---|
| PubChem CID | 145021507 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [(1S)-3-[(6S)-6-[(E)-hex-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methyl carbamate |
| SMILES | CCC/C=C/CO[C@H]1CCc2cc(C3CC[C@H](COC(N)=O)C3)ccc2C1 |
| InChI | InChI=1S/C23H33NO3/c1-2-3-4-5-12-26-22-11-10-20-14-19(8-9-21(20)15-22)18-7-6-17(13-18)16-27-23(24)25/h4-5,8-9,14,17-18,22H,2-3,6-7,10-13,15-16H2,1H3,(H2,24,25)/b5-4+/t17-,18?,22-/m0/s1 |
| InChIKey | FJTWDCLTFOSCJZ-XTVZCJERSA-N |
| XLogP | 4.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|