C25H43NO3 — CID 145021641
(1R)-3-[6-(2-butoxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-propan-2-ylcyclopentan-1-amine;methanol (PubChem CID 145021641) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is (1R)-3-[6-(2-butoxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-propan-2-ylcyclopentan-1-amine;methanol.
| Compound Name | (1R)-3-[6-(2-butoxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-propan-2-ylcyclopentan-1-amine;methanol |
|---|---|
| PubChem CID | 145021641 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | (1R)-3-[6-(2-butoxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]-N-propan-2-ylcyclopentan-1-amine;methanol |
| SMILES | CCCCOCCOC1CCc2cc(C3CC[C@@H](NC(C)C)C3)ccc2C1.CO |
| InChI | InChI=1S/C24H39NO2.CH4O/c1-4-5-12-26-13-14-27-24-11-9-20-15-19(6-7-22(20)17-24)21-8-10-23(16-21)25-18(2)3;1-2/h6-7,15,18,21,23-25H,4-5,8-14,16-17H2,1-3H3;2H,1H3/t21?,23-,24?;/m1./s1 |
| InChIKey | ISDGZHMADZFRCG-GBONEKRQSA-N |
| XLogP | 4.62 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|