C27H49NO2 — CID 145021637
(5R)-6-amino-5-[(6S)-6-[(Z)-hept-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol;ethane (PubChem CID 145021637) has the molecular formula C27H49NO2 and a molecular weight of 419.69 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6S)-6-[(Z)-hept-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol;ethane.
| Compound Name | (5R)-6-amino-5-[(6S)-6-[(Z)-hept-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol;ethane |
|---|---|
| PubChem CID | 145021637 |
| Molecular Formula | C27H49NO2 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 419.38 |
| IUPAC Name | (5R)-6-amino-5-[(6S)-6-[(Z)-hept-2-enoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol;ethane |
| SMILES | CC.CC.CCCC/C=C\CO[C@H]1CCc2cc([C@H](CN)CCCCO)ccc2C1 |
| InChI | InChI=1S/C23H37NO2.2C2H6/c1-2-3-4-5-8-15-26-23-13-12-19-16-20(10-11-21(19)17-23)22(18-24)9-6-7-14-25;2*1-2/h5,8,10-11,16,22-23,25H,2-4,6-7,9,12-15,17-18,24H2,1H3;2*1-2H3/b8-5-;;/t22-,23-;;/m0../s1 |
| InChIKey | OOMCDGGIHHXSTQ-ODJRUYGUSA-N |
| XLogP | 6.56 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|