C21H32F3NO2 — CID 138467665
(5R)-6-amino-5-[(6R)-6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 138467665) has the molecular formula C21H32F3NO2 and a molecular weight of 387.49 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6R)-6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6R)-6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 138467665 |
| Molecular Formula | C21H32F3NO2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (5R)-6-amino-5-[(6R)-6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | NCC(CCCCO)c1ccc2c(c1)CC[C@@H](COCCCC(F)(F)F)C2 |
| InChI | InChI=1S/C21H32F3NO2/c22-21(23,24)9-3-11-27-15-16-5-6-18-13-19(8-7-17(18)12-16)20(14-25)4-1-2-10-26/h7-8,13,16,20,26H,1-6,9-12,14-15,25H2/t16-,20?/m1/s1 |
| InChIKey | FIIMEGCCARIBSN-QRIPLOBPSA-N |
| XLogP | 4.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|