C24H30F3NO3 — CID 170025738
(5R)-6-amino-5-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 170025738) has the molecular formula C24H30F3NO3 and a molecular weight of 437.50 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 170025738 |
| Molecular Formula | C24H30F3NO3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (5R)-6-amino-5-[(6R)-6-[[3-(trifluoromethoxy)phenoxy]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | NC[C@H](CCCCO)c1ccc2c(c1)CC[C@@H](COc1cccc(OC(F)(F)F)c1)C2 |
| InChI | InChI=1S/C24H30F3NO3/c25-24(26,27)31-23-6-3-5-22(14-23)30-16-17-7-8-19-13-20(10-9-18(19)12-17)21(15-28)4-1-2-11-29/h3,5-6,9-10,13-14,17,21,29H,1-2,4,7-8,11-12,15-16,28H2/t17-,21+/m1/s1 |
| InChIKey | XHDGGUSNJDXHOD-UTKZUKDTSA-N |
| XLogP | 4.97 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|