C24H33NO2 — CID 138467658
(5R)-6-amino-5-[(6S)-6-[(2-methylphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 138467658) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6S)-6-[(2-methylphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6S)-6-[(2-methylphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 138467658 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | (5R)-6-amino-5-[(6S)-6-[(2-methylphenoxy)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | Cc1ccccc1OC[C@H]1CCc2cc([C@H](CN)CCCCO)ccc2C1 |
| InChI | InChI=1S/C24H33NO2/c1-18-6-2-3-8-24(18)27-17-19-9-10-21-15-22(12-11-20(21)14-19)23(16-25)7-4-5-13-26/h2-3,6,8,11-12,15,19,23,26H,4-5,7,9-10,13-14,16-17,25H2,1H3/t19-,23-/m0/s1 |
| InChIKey | FECSAGWZDLDYPI-CVDCTZTESA-N |
| XLogP | 4.38 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|