C21H35NOS — CID 138467941
(5R)-6-amino-5-[(6S)-6-(butylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 138467941) has the molecular formula C21H35NOS and a molecular weight of 349.58 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6S)-6-(butylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6S)-6-(butylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 138467941 |
| Molecular Formula | C21H35NOS |
| Molecular Weight | 349.58 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (5R)-6-amino-5-[(6S)-6-(butylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | CCCCSC[C@H]1CCc2cc([C@H](CN)CCCCO)ccc2C1 |
| InChI | InChI=1S/C21H35NOS/c1-2-3-12-24-16-17-7-8-19-14-20(10-9-18(19)13-17)21(15-22)6-4-5-11-23/h9-10,14,17,21,23H,2-8,11-13,15-16,22H2,1H3/t17-,21-/m0/s1 |
| InChIKey | UMAWORNSGVVEDF-UWJYYQICSA-N |
| XLogP | 4.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|