C24H39NO3 — CID 155097402
(5R)-6-amino-5-[(6S)-6-(2-cyclohexyloxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 155097402) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6S)-6-(2-cyclohexyloxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6S)-6-(2-cyclohexyloxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 155097402 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (5R)-6-amino-5-[(6S)-6-(2-cyclohexyloxyethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | NC[C@H](CCCCO)c1ccc2c(c1)CC[C@H](OCCOC1CCCCC1)C2 |
| InChI | InChI=1S/C24H39NO3/c25-18-22(6-4-5-13-26)20-9-10-21-17-24(12-11-19(21)16-20)28-15-14-27-23-7-2-1-3-8-23/h9-10,16,22-24,26H,1-8,11-15,17-18,25H2/t22-,24-/m0/s1 |
| InChIKey | OVFQDZYBGSSPLG-UPVQGACJSA-N |
| XLogP | 4.11 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|