C23H31NOS — CID 138467972
(5R)-6-amino-5-[(6R)-6-(phenylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 138467972) has the molecular formula C23H31NOS and a molecular weight of 369.57 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6R)-6-(phenylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6R)-6-(phenylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 138467972 |
| Molecular Formula | C23H31NOS |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (5R)-6-amino-5-[(6R)-6-(phenylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | NC[C@H](CCCCO)c1ccc2c(c1)CC[C@@H](CSc1ccccc1)C2 |
| InChI | InChI=1S/C23H31NOS/c24-16-22(6-4-5-13-25)21-12-11-19-14-18(9-10-20(19)15-21)17-26-23-7-2-1-3-8-23/h1-3,7-8,11-12,15,18,22,25H,4-6,9-10,13-14,16-17,24H2/t18-,22+/m1/s1 |
| InChIKey | NHZUFIBZJCSZFG-GCJKJVERSA-N |
| XLogP | 4.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|