C22H33N3O — CID 170026125
(5R)-6-amino-5-[6-[2-(3-methylimidazol-4-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 170026125) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is (5R)-6-amino-5-[6-[2-(3-methylimidazol-4-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[6-[2-(3-methylimidazol-4-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 170026125 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | (5R)-6-amino-5-[6-[2-(3-methylimidazol-4-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | Cn1cncc1CCC1CCc2cc([C@H](CN)CCCCO)ccc2C1 |
| InChI | InChI=1S/C22H33N3O/c1-25-16-24-15-22(25)10-6-17-5-7-19-13-20(9-8-18(19)12-17)21(14-23)4-2-3-11-26/h8-9,13,15-17,21,26H,2-7,10-12,14,23H2,1H3/t17?,21-/m0/s1 |
| InChIKey | WHNFJVJKPOFWFH-LFABVHOISA-N |
| XLogP | 3.36 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|