C20H33NOS — CID 155097114
(5R)-6-amino-5-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 155097114) has the molecular formula C20H33NOS and a molecular weight of 335.56 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 155097114 |
| Molecular Formula | C20H33NOS |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (5R)-6-amino-5-[(6S)-6-(propylsulfanylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | CCCSC[C@H]1CCc2cc([C@H](CN)CCCCO)ccc2C1 |
| InChI | InChI=1S/C20H33NOS/c1-2-11-23-15-16-6-7-18-13-19(9-8-17(18)12-16)20(14-21)5-3-4-10-22/h8-9,13,16,20,22H,2-7,10-12,14-15,21H2,1H3/t16-,20-/m0/s1 |
| InChIKey | QJUCJCAXUKAGRZ-JXFKEZNVSA-N |
| XLogP | 4.14 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|