C21H33NO — CID 155097407
(4R)-5-amino-4-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]pentan-1-ol (PubChem CID 155097407) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (4R)-5-amino-4-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]pentan-1-ol.
| Compound Name | (4R)-5-amino-4-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 155097407 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (4R)-5-amino-4-[(6R)-6-[(E)-hex-1-enyl]-5,6,7,8-tetrahydronaphthalen-2-yl]pentan-1-ol |
| SMILES | CCCC/C=C/[C@@H]1CCc2cc([C@H](CN)CCCO)ccc2C1 |
| InChI | InChI=1S/C21H33NO/c1-2-3-4-5-7-17-9-10-19-15-20(12-11-18(19)14-17)21(16-22)8-6-13-23/h5,7,11-12,15,17,21,23H,2-4,6,8-10,13-14,16,22H2,1H3/b7-5+/t17-,21+/m1/s1 |
| InChIKey | KUZYSRZFJYBNKF-PQGDUDRBSA-N |
| XLogP | 4.35 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|