C23H31NO2 — CID 138467979
(5R)-6-amino-5-[(6R)-6-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol (PubChem CID 138467979) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (5R)-6-amino-5-[(6R)-6-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol.
| Compound Name | (5R)-6-amino-5-[(6R)-6-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 138467979 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (5R)-6-amino-5-[(6R)-6-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl]hexan-1-ol |
| SMILES | NC[C@H](CCCCO)c1ccc2c(c1)CC[C@@H](OCc1ccccc1)C2 |
| InChI | InChI=1S/C23H31NO2/c24-16-22(8-4-5-13-25)20-9-10-21-15-23(12-11-19(21)14-20)26-17-18-6-2-1-3-7-18/h1-3,6-7,9-10,14,22-23,25H,4-5,8,11-13,15-17,24H2/t22-,23+/m0/s1 |
| InChIKey | AASZKGWKRQBGPW-XZOQPEGZSA-N |
| XLogP | 3.97 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|