C26H36N2O3 — CID 138467670
3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N,N-dimethylbenzamide (PubChem CID 138467670) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 138467670 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(OC[C@@H]2CCc3cc([C@H](CN)CCCCO)ccc3C2)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-28(2)26(30)23-7-5-8-25(16-23)31-18-19-9-10-21-15-22(12-11-20(21)14-19)24(17-27)6-3-4-13-29/h5,7-8,11-12,15-16,19,24,29H,3-4,6,9-10,13-14,17-18,27H2,1-2H3/t19-,24+/m1/s1 |
| InChIKey | NNELDVJRBLYAEO-DVECYGJZSA-N |
| XLogP | 3.78 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|