C27H38N2O3 — CID 155097356
3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N-ethyl-N-methylbenzamide (PubChem CID 155097356) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N-ethyl-N-methylbenzamide.
| Compound Name | 3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N-ethyl-N-methylbenzamide |
|---|---|
| PubChem CID | 155097356 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 3-[[(2R)-6-[(2R)-1-amino-6-hydroxyhexan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]-N-ethyl-N-methylbenzamide |
| SMILES | CCN(C)C(=O)c1cccc(OC[C@@H]2CCc3cc([C@H](CN)CCCCO)ccc3C2)c1 |
| InChI | InChI=1S/C27H38N2O3/c1-3-29(2)27(31)24-8-6-9-26(17-24)32-19-20-10-11-22-16-23(13-12-21(22)15-20)25(18-28)7-4-5-14-30/h6,8-9,12-13,16-17,20,25,30H,3-5,7,10-11,14-15,18-19,28H2,1-2H3/t20-,25+/m1/s1 |
| InChIKey | GOATXWSCRCDYQT-NLFFAJNJSA-N |
| XLogP | 4.17 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|