C20H28F3NO — CID 145021738
3-[6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentan-1-amine (PubChem CID 145021738) has the molecular formula C20H28F3NO and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentan-1-amine.
| Compound Name | 3-[6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 145021738 |
| Molecular Formula | C20H28F3NO |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 3-[6-(4,4,4-trifluorobutoxymethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentan-1-amine |
| SMILES | NC1CCC(c2ccc3c(c2)CCC(COCCCC(F)(F)F)C3)C1 |
| InChI | InChI=1S/C20H28F3NO/c21-20(22,23)8-1-9-25-13-14-2-3-16-11-17(5-4-15(16)10-14)18-6-7-19(24)12-18/h4-5,11,14,18-19H,1-3,6-10,12-13,24H2 |
| InChIKey | FQIYMSSKXOTEPM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|