C26H20F2N2S3 — CID 145023033
2,5-bis[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]thiophene-3,4-diamine (PubChem CID 145023033) has the molecular formula C26H20F2N2S3 and a molecular weight of 494.66 g/mol. Its IUPAC name is 2,5-bis[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]thiophene-3,4-diamine.
| Compound Name | 2,5-bis[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]thiophene-3,4-diamine |
|---|---|
| PubChem CID | 145023033 |
| Molecular Formula | C26H20F2N2S3 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 2,5-bis[5-(2-fluoro-4-methylphenyl)thiophen-2-yl]thiophene-3,4-diamine |
| SMILES | Cc1ccc(-c2ccc(-c3sc(-c4ccc(-c5ccc(C)cc5F)s4)c(N)c3N)s2)c(F)c1 |
| InChI | InChI=1S/C26H20F2N2S3/c1-13-3-5-15(17(27)11-13)19-7-9-21(31-19)25-23(29)24(30)26(33-25)22-10-8-20(32-22)16-6-4-14(2)12-18(16)28/h3-12H,29-30H2,1-2H3 |
| InChIKey | NKBAJWLRBVHJJI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |