C33H46F3NO — CID 145023941
3-methyloctane;1-methyl-3-prop-1-en-2-ylbenzene;1-[4-[1-(1,1,1-trifluorobutan-2-ylideneamino)ethenyl]phenyl]ethanone (PubChem CID 145023941) has the molecular formula C33H46F3NO and a molecular weight of 529.73 g/mol. Its IUPAC name is 3-methyloctane;1-methyl-3-prop-1-en-2-ylbenzene;1-[4-[1-(1,1,1-trifluorobutan-2-ylideneamino)ethenyl]phenyl]ethanone.
| Compound Name | 3-methyloctane;1-methyl-3-prop-1-en-2-ylbenzene;1-[4-[1-(1,1,1-trifluorobutan-2-ylideneamino)ethenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 145023941 |
| Molecular Formula | C33H46F3NO |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.35 |
| IUPAC Name | 3-methyloctane;1-methyl-3-prop-1-en-2-ylbenzene;1-[4-[1-(1,1,1-trifluorobutan-2-ylideneamino)ethenyl]phenyl]ethanone |
| SMILES | C=C(/N=C(\CC)C(F)(F)F)c1ccc(C(C)=O)cc1.C=C(C)c1cccc(C)c1.CCCCCC(C)CC |
| InChI | InChI=1S/C14H14F3NO.C10H12.C9H20/c1-4-13(14(15,16)17)18-9(2)11-5-7-12(8-6-11)10(3)19;1-8(2)10-6-4-5-9(3)7-10;1-4-6-7-8-9(3)5-2/h5-8H,2,4H2,1,3H3;4-7H,1H2,2-3H3;9H,4-8H2,1-3H3/b18-13+;; |
| InChIKey | BECYOJIFBIVXDA-YWABOPJLSA-N |
| XLogP | 10.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|