C16H15F3N8O — CID 145025590
N'-[N'-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]carbamimidoyl]methanimidamide (PubChem CID 145025590) has the molecular formula C16H15F3N8O and a molecular weight of 392.35 g/mol. Its IUPAC name is N'-[N'-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]carbamimidoyl]methanimidamide.
| Compound Name | N'-[N'-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]carbamimidoyl]methanimidamide |
|---|---|
| PubChem CID | 145025590 |
| Molecular Formula | C16H15F3N8O |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N'-[N'-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]carbamimidoyl]methanimidamide |
| SMILES | N/C=N\C(N)=N\c1nc(Nc2ccc3c(c2)CCC(=O)N3)ncc1C(F)(F)F |
| InChI | InChI=1S/C16H15F3N8O/c17-16(18,19)10-6-22-15(27-13(10)26-14(21)23-7-20)24-9-2-3-11-8(5-9)1-4-12(28)25-11/h2-3,5-7H,1,4H2,(H,25,28)(H5,20,21,22,23,24,26,27) |
| InChIKey | BOPJPIPWCZKBAT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|