C9H16N2O2 — CID 145026637
6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione;ethane (PubChem CID 145026637) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione;ethane.
| Compound Name | 6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione;ethane |
|---|---|
| PubChem CID | 145026637 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione;ethane |
| SMILES | CC.O=C1NC(=O)N2CCCCC12 |
| InChI | InChI=1S/C7H10N2O2.C2H6/c10-6-5-3-1-2-4-9(5)7(11)8-6;1-2/h5H,1-4H2,(H,8,10,11);1-2H3 |
| InChIKey | NHCPAQPVCKQXKM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|