C29H37N5O3 — CID 145026769
3-[(Z)-1-aminobut-1-enyl]-1-(4-methoxyphenyl)-4-[2-[N-methyl-4-[methyl(4-oxobutyl)amino]anilino]ethyl]pyrazole-5-carbaldehyde (PubChem CID 145026769) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 3-[(Z)-1-aminobut-1-enyl]-1-(4-methoxyphenyl)-4-[2-[N-methyl-4-[methyl(4-oxobutyl)amino]anilino]ethyl]pyrazole-5-carbaldehyde.
| Compound Name | 3-[(Z)-1-aminobut-1-enyl]-1-(4-methoxyphenyl)-4-[2-[N-methyl-4-[methyl(4-oxobutyl)amino]anilino]ethyl]pyrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 145026769 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | 3-[(Z)-1-aminobut-1-enyl]-1-(4-methoxyphenyl)-4-[2-[N-methyl-4-[methyl(4-oxobutyl)amino]anilino]ethyl]pyrazole-5-carbaldehyde |
| SMILES | CC/C=C(\N)c1nn(-c2ccc(OC)cc2)c(C=O)c1CCN(C)c1ccc(N(C)CCCC=O)cc1 |
| InChI | InChI=1S/C29H37N5O3/c1-5-8-27(30)29-26(28(21-36)34(31-29)24-13-15-25(37-4)16-14-24)17-19-33(3)23-11-9-22(10-12-23)32(2)18-6-7-20-35/h8-16,20-21H,5-7,17-19,30H2,1-4H3/b27-8- |
| InChIKey | QSORUVXJLBRXCO-PZOKPFNQSA-N |
| XLogP | 4.50 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|