C27H33N5O4 — CID 166676969
4-[2-[N-formyl-4-[methyl(5-oxopentyl)amino]anilino]ethyl]-1-(4-methoxyphenyl)-5-methylpyrazole-3-carboxamide (PubChem CID 166676969) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 4-[2-[N-formyl-4-[methyl(5-oxopentyl)amino]anilino]ethyl]-1-(4-methoxyphenyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | 4-[2-[N-formyl-4-[methyl(5-oxopentyl)amino]anilino]ethyl]-1-(4-methoxyphenyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 166676969 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 4-[2-[N-formyl-4-[methyl(5-oxopentyl)amino]anilino]ethyl]-1-(4-methoxyphenyl)-5-methylpyrazole-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(N)=O)c(CCN(C=O)c3ccc(N(C)CCCCC=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C27H33N5O4/c1-20-25(26(27(28)35)29-32(20)23-11-13-24(36-3)14-12-23)15-17-31(19-34)22-9-7-21(8-10-22)30(2)16-5-4-6-18-33/h7-14,18-19H,4-6,15-17H2,1-3H3,(H2,28,35) |
| InChIKey | NBQQAFXLQBZJGJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|