C29H32N4O — CID 145029408
4-[1-[(2R)-2-but-3-enoxypentyl]-5-(4-methylphenyl)pyrazolo[4,5-b]pyridin-6-yl]benzonitrile;molecular hydrogen (PubChem CID 145029408) has the molecular formula C29H32N4O and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-[1-[(2R)-2-but-3-enoxypentyl]-5-(4-methylphenyl)pyrazolo[4,5-b]pyridin-6-yl]benzonitrile;molecular hydrogen.
| Compound Name | 4-[1-[(2R)-2-but-3-enoxypentyl]-5-(4-methylphenyl)pyrazolo[4,5-b]pyridin-6-yl]benzonitrile;molecular hydrogen |
|---|---|
| PubChem CID | 145029408 |
| Molecular Formula | C29H32N4O |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 4-[1-[(2R)-2-but-3-enoxypentyl]-5-(4-methylphenyl)pyrazolo[4,5-b]pyridin-6-yl]benzonitrile;molecular hydrogen |
| SMILES | C=CCCO[C@H](CCC)Cn1ncc2nc(-c3ccc(C)cc3)c(-c3ccc(C#N)cc3)cc21.[H][H] |
| InChI | InChI=1S/C29H30N4O.H2/c1-4-6-16-34-25(7-5-2)20-33-28-17-26(23-14-10-22(18-30)11-15-23)29(32-27(28)19-31-33)24-12-8-21(3)9-13-24;/h4,8-15,17,19,25H,1,5-7,16,20H2,2-3H3;1H/t25-;/m1./s1 |
| InChIKey | MUNSZMRZIHFFJZ-VQIWEWKSSA-N |
| XLogP | 6.95 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|