C20H15BrN4O — CID 131745299
N'-[3-bromo-5-(4-cyanophenyl)-6-(4-methylphenyl)-2-pyridinyl]-N-hydroxymethanimidamide (PubChem CID 131745299) has the molecular formula C20H15BrN4O and a molecular weight of 407.27 g/mol. Its IUPAC name is N'-[3-bromo-5-(4-cyanophenyl)-6-(4-methylphenyl)-2-pyridinyl]-N-hydroxymethanimidamide.
| Compound Name | N'-[3-bromo-5-(4-cyanophenyl)-6-(4-methylphenyl)-2-pyridinyl]-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 131745299 |
| Molecular Formula | C20H15BrN4O |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N'-[3-bromo-5-(4-cyanophenyl)-6-(4-methylphenyl)-2-pyridinyl]-N-hydroxymethanimidamide |
| SMILES | Cc1ccc(-c2nc(N=CNO)c(Br)cc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H15BrN4O/c1-13-2-6-16(7-3-13)19-17(15-8-4-14(11-22)5-9-15)10-18(21)20(25-19)23-12-24-26/h2-10,12,26H,1H3,(H,23,24,25) |
| InChIKey | IQZQKNVGRNLMRD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|