C25H25N5 — CID 167185315
4-[6-methanimidoyl-2-(4-methylphenyl)-5-(piperidin-4-ylamino)-3-pyridinyl]benzonitrile (PubChem CID 167185315) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-[6-methanimidoyl-2-(4-methylphenyl)-5-(piperidin-4-ylamino)-3-pyridinyl]benzonitrile.
| Compound Name | 4-[6-methanimidoyl-2-(4-methylphenyl)-5-(piperidin-4-ylamino)-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 167185315 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[6-methanimidoyl-2-(4-methylphenyl)-5-(piperidin-4-ylamino)-3-pyridinyl]benzonitrile |
| SMILES | [H]/N=C/c1nc(-c2ccc(C)cc2)c(-c2ccc(C#N)cc2)cc1NC1CCNCC1 |
| InChI | InChI=1S/C25H25N5/c1-17-2-6-20(7-3-17)25-22(19-8-4-18(15-26)5-9-19)14-23(24(16-27)30-25)29-21-10-12-28-13-11-21/h2-9,14,16,21,27-29H,10-13H2,1H3/b27-16+ |
| InChIKey | CEXRMEVEAPPVJG-JVWAILMASA-N |
| XLogP | 4.76 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|