C24H23FN4 — CID 149410243
4-[2-[2-(3-fluoropyrrolidin-3-yl)ethyl]-5-(4-methylphenyl)pyrimidin-4-yl]benzonitrile (PubChem CID 149410243) has the molecular formula C24H23FN4 and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-[2-[2-(3-fluoropyrrolidin-3-yl)ethyl]-5-(4-methylphenyl)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-[2-[2-(3-fluoropyrrolidin-3-yl)ethyl]-5-(4-methylphenyl)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 149410243 |
| Molecular Formula | C24H23FN4 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[2-[2-(3-fluoropyrrolidin-3-yl)ethyl]-5-(4-methylphenyl)pyrimidin-4-yl]benzonitrile |
| SMILES | Cc1ccc(-c2cnc(CCC3(F)CCNC3)nc2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H23FN4/c1-17-2-6-19(7-3-17)21-15-28-22(10-11-24(25)12-13-27-16-24)29-23(21)20-8-4-18(14-26)5-9-20/h2-9,15,27H,10-13,16H2,1H3 |
| InChIKey | YRCJTVMOUKMMTA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |