C12H20 — CID 145030145
2,4,5,7a-tetrahydro-1H-indene;propane (PubChem CID 145030145) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,4,5,7a-tetrahydro-1H-indene;propane.
| Compound Name | 2,4,5,7a-tetrahydro-1H-indene;propane |
|---|---|
| PubChem CID | 145030145 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2,4,5,7a-tetrahydro-1H-indene;propane |
| SMILES | C1=CC2CCC=C2CC1.CCC |
| InChI | InChI=1S/C9H12.C3H8/c1-2-5-9-7-3-6-8(9)4-1;1-3-2/h1,4,7-8H,2-3,5-6H2;3H2,1-2H3 |
| InChIKey | AVKQXKKBQCRZIU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|