C11H18 — CID 90917521
3a,4,5,6-tetrahydro-1H-indene;ethane (PubChem CID 90917521) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydro-1H-indene;ethane.
| Compound Name | 3a,4,5,6-tetrahydro-1H-indene;ethane |
|---|---|
| PubChem CID | 90917521 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 3a,4,5,6-tetrahydro-1H-indene;ethane |
| SMILES | C1=CC2CCCC=C2C1.CC |
| InChI | InChI=1S/C9H12.C2H6/c1-2-5-9-7-3-6-8(9)4-1;1-2/h3-4,7,9H,1-2,5-6H2;1-2H3 |
| InChIKey | NDVRSUDCBBSFGD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|