C13H20 — CID 101316646
1-propan-2-yl-1,2,3,5,6,8a-hexahydronaphthalene (PubChem CID 101316646) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1-propan-2-yl-1,2,3,5,6,8a-hexahydronaphthalene.
| Compound Name | 1-propan-2-yl-1,2,3,5,6,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 101316646 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1-propan-2-yl-1,2,3,5,6,8a-hexahydronaphthalene |
| SMILES | CC(C)C1CCC=C2CCC=CC21 |
| InChI | InChI=1S/C13H20/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12/h4,7-8,10,12-13H,3,5-6,9H2,1-2H3 |
| InChIKey | KUUFEPPYBPFOHR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|