C21H30OS — CID 135048573
(1R,2S,3S,6Z,10S)-3-methyl-11-phenylsulfanyl-10-propan-2-ylbicyclo[5.3.1]undec-6-en-2-ol (PubChem CID 135048573) has the molecular formula C21H30OS and a molecular weight of 330.54 g/mol. Its IUPAC name is (1R,2S,3S,6Z,10S)-3-methyl-11-phenylsulfanyl-10-propan-2-ylbicyclo[5.3.1]undec-6-en-2-ol.
| Compound Name | (1R,2S,3S,6Z,10S)-3-methyl-11-phenylsulfanyl-10-propan-2-ylbicyclo[5.3.1]undec-6-en-2-ol |
|---|---|
| PubChem CID | 135048573 |
| Molecular Formula | C21H30OS |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (1R,2S,3S,6Z,10S)-3-methyl-11-phenylsulfanyl-10-propan-2-ylbicyclo[5.3.1]undec-6-en-2-ol |
| SMILES | CC(C)[C@@H]1CC/C2=C/CC[C@H](C)[C@H](O)[C@@H]1C2Sc1ccccc1 |
| InChI | InChI=1S/C21H30OS/c1-14(2)18-13-12-16-9-7-8-15(3)20(22)19(18)21(16)23-17-10-5-4-6-11-17/h4-6,9-11,14-15,18-22H,7-8,12-13H2,1-3H3/b16-9-/t15-,18-,19+,20-,21?/m0/s1 |
| InChIKey | OQZKDOBQCFHBCA-PLGOSDQISA-N |
| XLogP | 5.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|