C25H40N2O — CID 145030827
ethane;1-[3-[2-methylidenebut-3-enyl(pent-4-enyl)amino]propyl]-3,4-bis[(Z)-prop-1-enyl]-2H-pyrrol-5-one (PubChem CID 145030827) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is ethane;1-[3-[2-methylidenebut-3-enyl(pent-4-enyl)amino]propyl]-3,4-bis[(Z)-prop-1-enyl]-2H-pyrrol-5-one.
| Compound Name | ethane;1-[3-[2-methylidenebut-3-enyl(pent-4-enyl)amino]propyl]-3,4-bis[(Z)-prop-1-enyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 145030827 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | ethane;1-[3-[2-methylidenebut-3-enyl(pent-4-enyl)amino]propyl]-3,4-bis[(Z)-prop-1-enyl]-2H-pyrrol-5-one |
| SMILES | C=CCCCN(CCCN1CC(/C=C\C)=C(/C=C\C)C1=O)CC(=C)C=C.CC |
| InChI | InChI=1S/C23H34N2O.C2H6/c1-6-10-11-15-24(18-20(5)9-4)16-12-17-25-19-21(13-7-2)22(14-8-3)23(25)26;1-2/h6-9,13-14H,1,4-5,10-12,15-19H2,2-3H3;1-2H3/b13-7-,14-8-; |
| InChIKey | XRULWLCKPCIEOV-QMRHWWNPSA-N |
| XLogP | 5.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|