C37H31IS6 — CID 145031010
2-[6-(5-iodothiophen-2-yl)thieno[3,2-f][1]benzothiol-2-yl]-6-(5-nonan-2-ylthiophen-2-yl)thieno[3,2-f][1]benzothiole (PubChem CID 145031010) has the molecular formula C37H31IS6 and a molecular weight of 794.96 g/mol. Its IUPAC name is 2-[6-(5-iodothiophen-2-yl)thieno[3,2-f][1]benzothiol-2-yl]-6-(5-nonan-2-ylthiophen-2-yl)thieno[3,2-f][1]benzothiole.
| Compound Name | 2-[6-(5-iodothiophen-2-yl)thieno[3,2-f][1]benzothiol-2-yl]-6-(5-nonan-2-ylthiophen-2-yl)thieno[3,2-f][1]benzothiole |
|---|---|
| PubChem CID | 145031010 |
| Molecular Formula | C37H31IS6 |
| Molecular Weight | 794.96 g/mol |
| Exact Mass | 793.98 |
| IUPAC Name | 2-[6-(5-iodothiophen-2-yl)thieno[3,2-f][1]benzothiol-2-yl]-6-(5-nonan-2-ylthiophen-2-yl)thieno[3,2-f][1]benzothiole |
| SMILES | CCCCCCCC(C)c1ccc(-c2cc3cc4cc(-c5cc6cc7cc(-c8ccc(I)s8)sc7cc6s5)sc4cc3s2)s1 |
| InChI | InChI=1S/C37H31IS6/c1-3-4-5-6-7-8-21(2)26-9-10-27(39-26)33-15-22-13-24-17-35(42-31(24)19-29(22)40-33)36-18-25-14-23-16-34(28-11-12-37(38)44-28)41-30(23)20-32(25)43-36/h9-21H,3-8H2,1-2H3 |
| InChIKey | XXSRXPQLBVCEIO-UHFFFAOYSA-N |
| XLogP | 15.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.96 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|