C20H26O4S — CID 145031494
formic acid;[5-methoxy-2-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)phenyl]methanol (PubChem CID 145031494) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is formic acid;[5-methoxy-2-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)phenyl]methanol.
| Compound Name | formic acid;[5-methoxy-2-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 145031494 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | formic acid;[5-methoxy-2-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)phenyl]methanol |
| SMILES | COc1ccc(-c2sc3c(c2C)CC(C)(C)CC3)c(CO)c1.O=CO |
| InChI | InChI=1S/C19H24O2S.CH2O2/c1-12-16-10-19(2,3)8-7-17(16)22-18(12)15-6-5-14(21-4)9-13(15)11-20;2-1-3/h5-6,9,20H,7-8,10-11H2,1-4H3;1H,(H,2,3) |
| InChIKey | DMMLEGHJAJLNFT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|