C20H29NO3S2 — CID 145031207
formic acid;N-[[5-methoxy-2-(3,5,5-trimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophen-2-yl)phenyl]methyl]thiohydroxylamine (PubChem CID 145031207) has the molecular formula C20H29NO3S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is formic acid;N-[[5-methoxy-2-(3,5,5-trimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophen-2-yl)phenyl]methyl]thiohydroxylamine.
| Compound Name | formic acid;N-[[5-methoxy-2-(3,5,5-trimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophen-2-yl)phenyl]methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 145031207 |
| Molecular Formula | C20H29NO3S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | formic acid;N-[[5-methoxy-2-(3,5,5-trimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophen-2-yl)phenyl]methyl]thiohydroxylamine |
| SMILES | COc1ccc(C2SC3=C(CC(C)(C)CC3)C2C)c(CNS)c1.O=CO |
| InChI | InChI=1S/C19H27NOS2.CH2O2/c1-12-16-10-19(2,3)8-7-17(16)23-18(12)15-6-5-14(21-4)9-13(15)11-20-22;2-1-3/h5-6,9,12,18,20,22H,7-8,10-11H2,1-4H3;1H,(H,2,3) |
| InChIKey | MRXHQCJKISFQTP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|