C18H26N2OS2 — CID 145031624
3,5-dimethyl-1-(2-sulfanyloxyethyl)-4-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)pyrazole (PubChem CID 145031624) has the molecular formula C18H26N2OS2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-sulfanyloxyethyl)-4-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)pyrazole.
| Compound Name | 3,5-dimethyl-1-(2-sulfanyloxyethyl)-4-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)pyrazole |
|---|---|
| PubChem CID | 145031624 |
| Molecular Formula | C18H26N2OS2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3,5-dimethyl-1-(2-sulfanyloxyethyl)-4-(3,5,5-trimethyl-6,7-dihydro-4H-1-benzothiophen-2-yl)pyrazole |
| SMILES | Cc1nn(CCOS)c(C)c1-c1sc2c(c1C)CC(C)(C)CC2 |
| InChI | InChI=1S/C18H26N2OS2/c1-11-14-10-18(4,5)7-6-15(14)23-17(11)16-12(2)19-20(13(16)3)8-9-21-22/h22H,6-10H2,1-5H3 |
| InChIKey | GPVBXCNYAYEFHT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|