C21H26OS2 — CID 130240498
5,5-dimethyl-2-[2-methyl-3-(sulfanyloxymethyl)phenyl]-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophene (PubChem CID 130240498) has the molecular formula C21H26OS2 and a molecular weight of 358.57 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-methyl-3-(sulfanyloxymethyl)phenyl]-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophene.
| Compound Name | 5,5-dimethyl-2-[2-methyl-3-(sulfanyloxymethyl)phenyl]-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophene |
|---|---|
| PubChem CID | 130240498 |
| Molecular Formula | C21H26OS2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5,5-dimethyl-2-[2-methyl-3-(sulfanyloxymethyl)phenyl]-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophene |
| SMILES | C=C(C)c1c(-c2cccc(COS)c2C)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C21H26OS2/c1-13(2)19-17-11-21(4,5)10-9-18(17)24-20(19)16-8-6-7-15(12-22-23)14(16)3/h6-8,23H,1,9-12H2,2-5H3 |
| InChIKey | ZVXLRFJSBPEQSN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|