C21H26O4 — CID 145039195
ethane;methyl 3-methoxy-3-(3-phenoxyphenyl)cyclobutane-1-carboxylate (PubChem CID 145039195) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethane;methyl 3-methoxy-3-(3-phenoxyphenyl)cyclobutane-1-carboxylate.
| Compound Name | ethane;methyl 3-methoxy-3-(3-phenoxyphenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 145039195 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | ethane;methyl 3-methoxy-3-(3-phenoxyphenyl)cyclobutane-1-carboxylate |
| SMILES | CC.COC(=O)C1CC(OC)(c2cccc(Oc3ccccc3)c2)C1 |
| InChI | InChI=1S/C19H20O4.C2H6/c1-21-18(20)14-12-19(13-14,22-2)15-7-6-10-17(11-15)23-16-8-4-3-5-9-16;1-2/h3-11,14H,12-13H2,1-2H3;1-2H3 |
| InChIKey | GEOZOSGYYPAHTH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |