C12H22N2 — CID 145046783
N-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propan-2-imine (PubChem CID 145046783) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propan-2-imine.
| Compound Name | N-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propan-2-imine |
|---|---|
| PubChem CID | 145046783 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-5-yl)propan-2-imine |
| SMILES | CC(C)=NC1=C(C)CCN(C(C)C)C1 |
| InChI | InChI=1S/C12H22N2/c1-9(2)13-12-8-14(10(3)4)7-6-11(12)5/h10H,6-8H2,1-5H3 |
| InChIKey | NKOZECLQWULAHS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|