About butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine
butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine (PubChem CID 170635801) has the molecular formula C16H34N2
and a molecular weight of 254.46 g/mol. Its IUPAC name is butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine.
Molecular Properties
| Compound Name | butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine |
| PubChem CID | 170635801 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine |
| SMILES | C/C=N/C1=C(C)CCN(CC)C1.CC.CCCC |
| InChI | InChI=1S/C10H18N2.C4H10.C2H6/c1-4-11-10-8-12(5-2)7-6-9(10)3;1-3-4-2;1-2/h4H,5-8H2,1-3H3;3-4H2,1-2H3;1-2H3/b11-4+;; |
| InChIKey | GKLKYYLXPKUTIB-QKBHCULISA-N |
| XLogP | 4.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
The IUPAC name of butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine (CID 170635801) is butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine.
What is the SMILES notation for butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
The canonical SMILES for butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine is C/C=N/C1=C(C)CCN(CC)C1.CC.CCCC.
What is the InChIKey of butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
The InChIKey is GKLKYYLXPKUTIB-QKBHCULISA-N. The full InChI is InChI=1S/C10H18N2.C4H10.C2H6/c1-4-11-10-8-12(5-2)7-6-9(10)3;1-3-4-2;1-2/h4H,5-8H2,1-3H3;3-4H2,1-2H3;1-2H3/b11-4+;;.
What are the key properties of butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine?
butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine has a molecular weight of 254.46 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;N-(1-ethyl-4-methyl-3,6-dihydro-2H-pyridin-5-yl)ethanimine is sourced from PubChem (CID 170635801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).