C17H32N2 — CID 20871995
1-butyl-5,6-ditert-butyl-2,7-dihydro-1,4-diazepine (PubChem CID 20871995) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-butyl-5,6-ditert-butyl-2,7-dihydro-1,4-diazepine.
| Compound Name | 1-butyl-5,6-ditert-butyl-2,7-dihydro-1,4-diazepine |
|---|---|
| PubChem CID | 20871995 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-butyl-5,6-ditert-butyl-2,7-dihydro-1,4-diazepine |
| SMILES | CCCCN1CC=NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H32N2/c1-8-9-11-19-12-10-18-15(17(5,6)7)14(13-19)16(2,3)4/h10H,8-9,11-13H2,1-7H3 |
| InChIKey | ZQZAAHCAYDALCI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |